C17H18N2O4S3 — CID 1259551
4-methyl-N-[3-(4-methylphenyl)sulfonyl-1,3-thiazolidin-2-ylidene]benzenesulfonamide (PubChem CID 1259551) has the molecular formula C17H18N2O4S3 and a molecular weight of 410.54 g/mol. Its IUPAC name is 4-methyl-N-[3-(4-methylphenyl)sulfonyl-1,3-thiazolidin-2-ylidene]benzenesulfonamide.
| Compound Name | 4-methyl-N-[3-(4-methylphenyl)sulfonyl-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 1259551 |
| Molecular Formula | C17H18N2O4S3 |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | 4-methyl-N-[3-(4-methylphenyl)sulfonyl-1,3-thiazolidin-2-ylidene]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=C2SCCN2S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C17H18N2O4S3/c1-13-3-7-15(8-4-13)25(20,21)18-17-19(11-12-24-17)26(22,23)16-9-5-14(2)6-10-16/h3-10H,11-12H2,1-2H3 |
| InChIKey | AAJTZIPZKKFJPB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 83.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|