About 8-(4-chlorophenyl)-N,N-dimethyl-1,4-dioxaspiro[4.5]decan-8-amine;hydrochloride
8-(4-chlorophenyl)-N,N-dimethyl-1,4-dioxaspiro[4.5]decan-8-amine;hydrochloride (PubChem CID 12595632) has the molecular formula C16H23Cl2NO2
and a molecular weight of 332.27 g/mol. Its IUPAC name is 8-(4-chlorophenyl)-N,N-dimethyl-1,4-dioxaspiro[4.5]decan-8-amine;hydrochloride.
Molecular Properties
| Compound Name | 8-(4-chlorophenyl)-N,N-dimethyl-1,4-dioxaspiro[4.5]decan-8-amine;hydrochloride |
| PubChem CID | 12595632 |
| Molecular Formula | C16H23Cl2NO2 |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 8-(4-chlorophenyl)-N,N-dimethyl-1,4-dioxaspiro[4.5]decan-8-amine;hydrochloride |
| SMILES | CN(C)C1(c2ccc(Cl)cc2)CCC2(CC1)OCCO2.Cl |
| InChI | InChI=1S/C16H22ClNO2.ClH/c1-18(2)15(13-3-5-14(17)6-4-13)7-9-16(10-8-15)19-11-12-20-16;/h3-6H,7-12H2,1-2H3;1H |
| InChIKey | OJFFXZWEUQJQHV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-(4-chlorophenyl)-N,N-dimethyl-1,4-dioxaspiro[4.5]decan-8-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(4-chlorophenyl)-N,N-dimethyl-1,4-dioxaspiro[4.5]decan-8-amine;hydrochloride?
The IUPAC name of 8-(4-chlorophenyl)-N,N-dimethyl-1,4-dioxaspiro[4.5]decan-8-amine;hydrochloride (CID 12595632) is 8-(4-chlorophenyl)-N,N-dimethyl-1,4-dioxaspiro[4.5]decan-8-amine;hydrochloride.
What is the SMILES notation for 8-(4-chlorophenyl)-N,N-dimethyl-1,4-dioxaspiro[4.5]decan-8-amine;hydrochloride?
The canonical SMILES for 8-(4-chlorophenyl)-N,N-dimethyl-1,4-dioxaspiro[4.5]decan-8-amine;hydrochloride is CN(C)C1(c2ccc(Cl)cc2)CCC2(CC1)OCCO2.Cl.
What is the InChIKey of 8-(4-chlorophenyl)-N,N-dimethyl-1,4-dioxaspiro[4.5]decan-8-amine;hydrochloride?
The InChIKey is OJFFXZWEUQJQHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22ClNO2.ClH/c1-18(2)15(13-3-5-14(17)6-4-13)7-9-16(10-8-15)19-11-12-20-16;/h3-6H,7-12H2,1-2H3;1H.
What are the key properties of 8-(4-chlorophenyl)-N,N-dimethyl-1,4-dioxaspiro[4.5]decan-8-amine;hydrochloride?
8-(4-chlorophenyl)-N,N-dimethyl-1,4-dioxaspiro[4.5]decan-8-amine;hydrochloride has a molecular weight of 332.27 g/mol, XLogP of 3.84, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(4-chlorophenyl)-N,N-dimethyl-1,4-dioxaspiro[4.5]decan-8-amine;hydrochloride is sourced from PubChem (CID 12595632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).