About (1-methoxy-2,2-dimethylhexa-3,4-dien-3-yl)benzene
(1-methoxy-2,2-dimethylhexa-3,4-dien-3-yl)benzene (PubChem CID 12596338) has the molecular formula C15H20O
and a molecular weight of 216.32 g/mol. Its IUPAC name is (1-methoxy-2,2-dimethylhexa-3,4-dien-3-yl)benzene.
Molecular Properties
| Compound Name | (1-methoxy-2,2-dimethylhexa-3,4-dien-3-yl)benzene |
| PubChem CID | 12596338 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (1-methoxy-2,2-dimethylhexa-3,4-dien-3-yl)benzene |
| SMILES | CC=C=C(c1ccccc1)C(C)(C)COC |
| InChI | InChI=1S/C15H20O/c1-5-9-14(15(2,3)12-16-4)13-10-7-6-8-11-13/h5-8,10-11H,12H2,1-4H3 |
| InChIKey | MRWQGNZRMLFBGN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1-methoxy-2,2-dimethylhexa-3,4-dien-3-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methoxy-2,2-dimethylhexa-3,4-dien-3-yl)benzene?
The IUPAC name of (1-methoxy-2,2-dimethylhexa-3,4-dien-3-yl)benzene (CID 12596338) is (1-methoxy-2,2-dimethylhexa-3,4-dien-3-yl)benzene.
What is the SMILES notation for (1-methoxy-2,2-dimethylhexa-3,4-dien-3-yl)benzene?
The canonical SMILES for (1-methoxy-2,2-dimethylhexa-3,4-dien-3-yl)benzene is CC=C=C(c1ccccc1)C(C)(C)COC.
What is the InChIKey of (1-methoxy-2,2-dimethylhexa-3,4-dien-3-yl)benzene?
The InChIKey is MRWQGNZRMLFBGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O/c1-5-9-14(15(2,3)12-16-4)13-10-7-6-8-11-13/h5-8,10-11H,12H2,1-4H3.
What are the key properties of (1-methoxy-2,2-dimethylhexa-3,4-dien-3-yl)benzene?
(1-methoxy-2,2-dimethylhexa-3,4-dien-3-yl)benzene has a molecular weight of 216.32 g/mol, XLogP of 3.92, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methoxy-2,2-dimethylhexa-3,4-dien-3-yl)benzene is sourced from PubChem (CID 12596338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).