C9F18O — CID 12596607
2,2,3,3,4,4,5,5,6-nonafluoro-6-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)oxane (PubChem CID 12596607) has the molecular formula C9F18O and a molecular weight of 466.06 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6-nonafluoro-6-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)oxane.
| Compound Name | 2,2,3,3,4,4,5,5,6-nonafluoro-6-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)oxane |
|---|---|
| PubChem CID | 12596607 |
| Molecular Formula | C9F18O |
| Molecular Weight | 466.06 g/mol |
| Exact Mass | 465.97 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6-nonafluoro-6-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)oxane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)OC(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C9F18O/c10-1(11,5(18,19)8(23,24)25)3(14,15)7(22)4(16,17)2(12,13)6(20,21)9(26,27)28-7 |
| InChIKey | SANNKXBEAQBMQE-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.06 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|