C10F20O — CID 12596608
2,2,3,3,4,4,5,5,6-nonafluoro-6-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)oxane (PubChem CID 12596608) has the molecular formula C10F20O and a molecular weight of 516.07 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6-nonafluoro-6-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)oxane.
| Compound Name | 2,2,3,3,4,4,5,5,6-nonafluoro-6-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)oxane |
|---|---|
| PubChem CID | 12596608 |
| Molecular Formula | C10F20O |
| Molecular Weight | 516.07 g/mol |
| Exact Mass | 515.96 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6-nonafluoro-6-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)oxane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)OC(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10F20O/c11-1(12,2(13,14)6(21,22)9(26,27)28)4(17,18)8(25)5(19,20)3(15,16)7(23,24)10(29,30)31-8 |
| InChIKey | OGVMAWKPAZCAKM-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.07 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|