C12H20OSi — CID 12596786
trimethyl-[(3E,5E,7E)-nona-1,3,5,7-tetraen-2-yl]oxysilane (PubChem CID 12596786) has the molecular formula C12H20OSi and a molecular weight of 208.38 g/mol. Its IUPAC name is trimethyl-[(3E,5E,7E)-nona-1,3,5,7-tetraen-2-yl]oxysilane.
| Compound Name | trimethyl-[(3E,5E,7E)-nona-1,3,5,7-tetraen-2-yl]oxysilane |
|---|---|
| PubChem CID | 12596786 |
| Molecular Formula | C12H20OSi |
| Molecular Weight | 208.38 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | trimethyl-[(3E,5E,7E)-nona-1,3,5,7-tetraen-2-yl]oxysilane |
| SMILES | C=C(/C=C/C=C/C=C/C)O[Si](C)(C)C |
| InChI | InChI=1S/C12H20OSi/c1-6-7-8-9-10-11-12(2)13-14(3,4)5/h6-11H,2H2,1,3-5H3/b7-6+,9-8+,11-10+ |
| InChIKey | VPAQXXNTUYLJTA-OBWVEWQSSA-N |
| XLogP | 4.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|