About [2-[2,2-bis(phenyldiazenyl)ethenoxy]-1-phenyldiazenylethenyl]-phenyldiazene
[2-[2,2-bis(phenyldiazenyl)ethenoxy]-1-phenyldiazenylethenyl]-phenyldiazene (PubChem CID 12597169) has the molecular formula C28H22N8O
and a molecular weight of 486.54 g/mol. Its IUPAC name is [2-[2,2-bis(phenyldiazenyl)ethenoxy]-1-phenyldiazenylethenyl]-phenyldiazene.
Molecular Properties
| Compound Name | [2-[2,2-bis(phenyldiazenyl)ethenoxy]-1-phenyldiazenylethenyl]-phenyldiazene |
| PubChem CID | 12597169 |
| Molecular Formula | C28H22N8O |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | [2-[2,2-bis(phenyldiazenyl)ethenoxy]-1-phenyldiazenylethenyl]-phenyldiazene |
| SMILES | C(OC=C(/N=N/c1ccccc1)/N=N/c1ccccc1)=C(/N=N/c1ccccc1)/N=N/c1ccccc1 |
| InChI | InChI=1S/C28H22N8O/c1-5-13-23(14-6-1)29-33-27(34-30-24-15-7-2-8-16-24)21-37-22-28(35-31-25-17-9-3-10-18-25)36-32-26-19-11-4-12-20-26/h1-22H/b33-29+,34-30+,35-31+,36-32+ |
| InChIKey | FGECCKRPJMBDAQ-MCTOCYMBSA-N |
| XLogP | 9.74 |
| TPSA | 108.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze [2-[2,2-bis(phenyldiazenyl)ethenoxy]-1-phenyldiazenylethenyl]-phenyldiazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2,2-bis(phenyldiazenyl)ethenoxy]-1-phenyldiazenylethenyl]-phenyldiazene?
The IUPAC name of [2-[2,2-bis(phenyldiazenyl)ethenoxy]-1-phenyldiazenylethenyl]-phenyldiazene (CID 12597169) is [2-[2,2-bis(phenyldiazenyl)ethenoxy]-1-phenyldiazenylethenyl]-phenyldiazene.
What is the SMILES notation for [2-[2,2-bis(phenyldiazenyl)ethenoxy]-1-phenyldiazenylethenyl]-phenyldiazene?
The canonical SMILES for [2-[2,2-bis(phenyldiazenyl)ethenoxy]-1-phenyldiazenylethenyl]-phenyldiazene is C(OC=C(/N=N/c1ccccc1)/N=N/c1ccccc1)=C(/N=N/c1ccccc1)/N=N/c1ccccc1.
What is the InChIKey of [2-[2,2-bis(phenyldiazenyl)ethenoxy]-1-phenyldiazenylethenyl]-phenyldiazene?
The InChIKey is FGECCKRPJMBDAQ-MCTOCYMBSA-N. The full InChI is InChI=1S/C28H22N8O/c1-5-13-23(14-6-1)29-33-27(34-30-24-15-7-2-8-16-24)21-37-22-28(35-31-25-17-9-3-10-18-25)36-32-26-19-11-4-12-20-26/h1-22H/b33-29+,34-30+,35-31+,36-32+.
What are the key properties of [2-[2,2-bis(phenyldiazenyl)ethenoxy]-1-phenyldiazenylethenyl]-phenyldiazene?
[2-[2,2-bis(phenyldiazenyl)ethenoxy]-1-phenyldiazenylethenyl]-phenyldiazene has a molecular weight of 486.54 g/mol, XLogP of 9.74, 10 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2,2-bis(phenyldiazenyl)ethenoxy]-1-phenyldiazenylethenyl]-phenyldiazene is sourced from PubChem (CID 12597169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).