About 1-benzyl-3-chloropyrazolo[5,4-b]pyridine
1-benzyl-3-chloropyrazolo[5,4-b]pyridine (PubChem CID 12597363) has the molecular formula C13H10ClN3
and a molecular weight of 243.70 g/mol. Its IUPAC name is 1-benzyl-3-chloropyrazolo[5,4-b]pyridine.
Molecular Properties
| Compound Name | 1-benzyl-3-chloropyrazolo[5,4-b]pyridine |
| PubChem CID | 12597363 |
| Molecular Formula | C13H10ClN3 |
| Molecular Weight | 243.70 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 1-benzyl-3-chloropyrazolo[5,4-b]pyridine |
| SMILES | Clc1nn(Cc2ccccc2)c2ncccc12 |
| InChI | InChI=1S/C13H10ClN3/c14-12-11-7-4-8-15-13(11)17(16-12)9-10-5-2-1-3-6-10/h1-8H,9H2 |
| InChIKey | MQUNBMCCKBDPQC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.70 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzyl-3-chloropyrazolo[5,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3-chloropyrazolo[5,4-b]pyridine?
The IUPAC name of 1-benzyl-3-chloropyrazolo[5,4-b]pyridine (CID 12597363) is 1-benzyl-3-chloropyrazolo[5,4-b]pyridine.
What is the SMILES notation for 1-benzyl-3-chloropyrazolo[5,4-b]pyridine?
The canonical SMILES for 1-benzyl-3-chloropyrazolo[5,4-b]pyridine is Clc1nn(Cc2ccccc2)c2ncccc12.
What is the InChIKey of 1-benzyl-3-chloropyrazolo[5,4-b]pyridine?
The InChIKey is MQUNBMCCKBDPQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClN3/c14-12-11-7-4-8-15-13(11)17(16-12)9-10-5-2-1-3-6-10/h1-8H,9H2.
What are the key properties of 1-benzyl-3-chloropyrazolo[5,4-b]pyridine?
1-benzyl-3-chloropyrazolo[5,4-b]pyridine has a molecular weight of 243.70 g/mol, XLogP of 3.13, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3-chloropyrazolo[5,4-b]pyridine is sourced from PubChem (CID 12597363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).