C12H24O5 — CID 12597912
2,2-dimethyl-1,4,7,10,13-pentaoxacyclopentadecane (PubChem CID 12597912) has the molecular formula C12H24O5 and a molecular weight of 248.32 g/mol. Its IUPAC name is 2,2-dimethyl-1,4,7,10,13-pentaoxacyclopentadecane.
| Compound Name | 2,2-dimethyl-1,4,7,10,13-pentaoxacyclopentadecane |
|---|---|
| PubChem CID | 12597912 |
| Molecular Formula | C12H24O5 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 2,2-dimethyl-1,4,7,10,13-pentaoxacyclopentadecane |
| SMILES | CC1(C)COCCOCCOCCOCCO1 |
| InChI | InChI=1S/C12H24O5/c1-12(2)11-16-8-7-14-4-3-13-5-6-15-9-10-17-12/h3-11H2,1-2H3 |
| InChIKey | DFAFZVPNKONQTA-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |