C10H20O4 — CID 12597933
2,2-dimethyl-1,4,7,10-tetraoxacyclododecane (PubChem CID 12597933) has the molecular formula C10H20O4 and a molecular weight of 204.27 g/mol. Its IUPAC name is 2,2-dimethyl-1,4,7,10-tetraoxacyclododecane.
| Compound Name | 2,2-dimethyl-1,4,7,10-tetraoxacyclododecane |
|---|---|
| PubChem CID | 12597933 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 2,2-dimethyl-1,4,7,10-tetraoxacyclododecane |
| SMILES | CC1(C)COCCOCCOCCO1 |
| InChI | InChI=1S/C10H20O4/c1-10(2)9-13-6-5-11-3-4-12-7-8-14-10/h3-9H2,1-2H3 |
| InChIKey | QKGREUBKUYOBTR-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |