C8H12 — CID 12599190
1,6-dimethylcyclohexa-1,3-diene (PubChem CID 12599190) has the molecular formula C8H12 and a molecular weight of 108.18 g/mol. Its IUPAC name is 1,6-dimethylcyclohexa-1,3-diene.
| Compound Name | 1,6-dimethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 12599190 |
| Molecular Formula | C8H12 |
| Molecular Weight | 108.18 g/mol |
| Exact Mass | 108.09 |
| IUPAC Name | 1,6-dimethylcyclohexa-1,3-diene |
| SMILES | CC1=CC=CCC1C |
| InChI | InChI=1S/C8H12/c1-7-5-3-4-6-8(7)2/h3-5,8H,6H2,1-2H3 |
| InChIKey | LHNLHNXVJMSGDW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 108.18 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |