About (4E)-4-diethoxyphosphoryl-3-ethoxy-2-methylhexa-2,4-diene
(4E)-4-diethoxyphosphoryl-3-ethoxy-2-methylhexa-2,4-diene (PubChem CID 12599213) has the molecular formula C13H25O4P
and a molecular weight of 276.31 g/mol. Its IUPAC name is (4E)-4-diethoxyphosphoryl-3-ethoxy-2-methylhexa-2,4-diene.
Molecular Properties
| Compound Name | (4E)-4-diethoxyphosphoryl-3-ethoxy-2-methylhexa-2,4-diene |
| PubChem CID | 12599213 |
| Molecular Formula | C13H25O4P |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | (4E)-4-diethoxyphosphoryl-3-ethoxy-2-methylhexa-2,4-diene |
| SMILES | C/C=C(\C(OCC)=C(C)C)P(=O)(OCC)OCC |
| InChI | InChI=1S/C13H25O4P/c1-7-12(13(11(5)6)15-8-2)18(14,16-9-3)17-10-4/h7H,8-10H2,1-6H3/b12-7+ |
| InChIKey | CWPOGLNVPQCDHA-KPKJPENVSA-N |
| XLogP | 4.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-4-diethoxyphosphoryl-3-ethoxy-2-methylhexa-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-diethoxyphosphoryl-3-ethoxy-2-methylhexa-2,4-diene?
The IUPAC name of (4E)-4-diethoxyphosphoryl-3-ethoxy-2-methylhexa-2,4-diene (CID 12599213) is (4E)-4-diethoxyphosphoryl-3-ethoxy-2-methylhexa-2,4-diene.
What is the SMILES notation for (4E)-4-diethoxyphosphoryl-3-ethoxy-2-methylhexa-2,4-diene?
The canonical SMILES for (4E)-4-diethoxyphosphoryl-3-ethoxy-2-methylhexa-2,4-diene is C/C=C(\C(OCC)=C(C)C)P(=O)(OCC)OCC.
What is the InChIKey of (4E)-4-diethoxyphosphoryl-3-ethoxy-2-methylhexa-2,4-diene?
The InChIKey is CWPOGLNVPQCDHA-KPKJPENVSA-N. The full InChI is InChI=1S/C13H25O4P/c1-7-12(13(11(5)6)15-8-2)18(14,16-9-3)17-10-4/h7H,8-10H2,1-6H3/b12-7+.
What are the key properties of (4E)-4-diethoxyphosphoryl-3-ethoxy-2-methylhexa-2,4-diene?
(4E)-4-diethoxyphosphoryl-3-ethoxy-2-methylhexa-2,4-diene has a molecular weight of 276.31 g/mol, XLogP of 4.49, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-diethoxyphosphoryl-3-ethoxy-2-methylhexa-2,4-diene is sourced from PubChem (CID 12599213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).