C27H21N3O3 — CID 12599630
(6,9-dibenzoyl-3,6,9-triazatetracyclo[6.1.0.02,4.05,7]nonan-3-yl)-phenylmethanone (PubChem CID 12599630) has the molecular formula C27H21N3O3 and a molecular weight of 435.48 g/mol. Its IUPAC name is (6,9-dibenzoyl-3,6,9-triazatetracyclo[6.1.0.02,4.05,7]nonan-3-yl)-phenylmethanone.
| Compound Name | (6,9-dibenzoyl-3,6,9-triazatetracyclo[6.1.0.02,4.05,7]nonan-3-yl)-phenylmethanone |
|---|---|
| PubChem CID | 12599630 |
| Molecular Formula | C27H21N3O3 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | (6,9-dibenzoyl-3,6,9-triazatetracyclo[6.1.0.02,4.05,7]nonan-3-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1C2C3C(C4C(C21)N4C(=O)c1ccccc1)N3C(=O)c1ccccc1 |
| InChI | InChI=1S/C27H21N3O3/c31-25(16-10-4-1-5-11-16)28-19-20(28)22-24(30(22)27(33)18-14-8-3-9-15-18)23-21(19)29(23)26(32)17-12-6-2-7-13-17/h1-15,19-24H |
| InChIKey | LQQABARYEDPDBG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 60.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|