C9H15N3 — CID 12599645
(2Z,5Z,8Z)-1,4,7-trimethyl-1,4,7-triazonine (PubChem CID 12599645) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is (2Z,5Z,8Z)-1,4,7-trimethyl-1,4,7-triazonine.
| Compound Name | (2Z,5Z,8Z)-1,4,7-trimethyl-1,4,7-triazonine |
|---|---|
| PubChem CID | 12599645 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | (2Z,5Z,8Z)-1,4,7-trimethyl-1,4,7-triazonine |
| SMILES | CN1/C=C\N(C)/C=C\N(C)/C=C\1 |
| InChI | InChI=1S/C9H15N3/c1-10-4-6-11(2)8-9-12(3)7-5-10/h4-9H,1-3H3/b6-4-,7-5-,9-8- |
| InChIKey | ACUHANXUISGPMY-WRQXQGDDSA-N |
| XLogP | 1.21 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |