About 4-hydroxybenzaldehyde
4-hydroxybenzaldehyde (PubChem CID 126) has the molecular formula C7H6O2
and a molecular weight of 122.12 g/mol. Its IUPAC name is 4-hydroxybenzaldehyde.
Molecular Properties
| Compound Name | 4-hydroxybenzaldehyde |
| PubChem CID | 126 |
| Molecular Formula | C7H6O2 |
| Molecular Weight | 122.12 g/mol |
| Exact Mass | 122.04 |
| IUPAC Name | 4-hydroxybenzaldehyde |
| SMILES | O=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C7H6O2/c8-5-6-1-3-7(9)4-2-6/h1-5,9H |
| InChIKey | RGHHSNMVTDWUBI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.12 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxybenzaldehyde?
The IUPAC name of 4-hydroxybenzaldehyde (CID 126) is 4-hydroxybenzaldehyde.
What is the SMILES notation for 4-hydroxybenzaldehyde?
The canonical SMILES for 4-hydroxybenzaldehyde is O=Cc1ccc(O)cc1.
What is the InChIKey of 4-hydroxybenzaldehyde?
The InChIKey is RGHHSNMVTDWUBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2/c8-5-6-1-3-7(9)4-2-6/h1-5,9H.
What are the key properties of 4-hydroxybenzaldehyde?
4-hydroxybenzaldehyde has a molecular weight of 122.12 g/mol, XLogP of 1.20, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxybenzaldehyde is sourced from PubChem (CID 126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).