C29H23Cl3N2O5 — CID 126000692
(5Z)-1-(3-chloro-4-methylphenyl)-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 126000692) has the molecular formula C29H23Cl3N2O5 and a molecular weight of 585.87 g/mol. Its IUPAC name is (5Z)-1-(3-chloro-4-methylphenyl)-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-1-(3-chloro-4-methylphenyl)-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126000692 |
| Molecular Formula | C29H23Cl3N2O5 |
| Molecular Weight | 585.87 g/mol |
| Exact Mass | 584.07 |
| IUPAC Name | (5Z)-1-(3-chloro-4-methylphenyl)-5-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCc1cc(/C=C2/C(=O)NC(=O)N(c3ccc(C)c(Cl)c3)C2=O)cc(OC)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C29H23Cl3N2O5/c1-4-5-19-10-18(13-25(38-3)26(19)39-15-17-7-9-22(30)24(32)12-17)11-21-27(35)33-29(37)34(28(21)36)20-8-6-16(2)23(31)14-20/h4,6-14H,1,5,15H2,2-3H3,(H,33,35,37)/b21-11- |
| InChIKey | YGANJXUJSFYHNV-NHDPSOOVSA-N |
| XLogP | 6.94 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.87 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|