About 2-(2,2-diethoxyethoxy)propane
2-(2,2-diethoxyethoxy)propane (PubChem CID 12600150) has the molecular formula C9H20O3
and a molecular weight of 176.26 g/mol. Its IUPAC name is 2-(2,2-diethoxyethoxy)propane.
Molecular Properties
| Compound Name | 2-(2,2-diethoxyethoxy)propane |
| PubChem CID | 12600150 |
| Molecular Formula | C9H20O3 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.14 |
| IUPAC Name | 2-(2,2-diethoxyethoxy)propane |
| SMILES | CCOC(COC(C)C)OCC |
| InChI | InChI=1S/C9H20O3/c1-5-10-9(11-6-2)7-12-8(3)4/h8-9H,5-7H2,1-4H3 |
| InChIKey | APQLLWRAYFLKQA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-diethoxyethoxy)propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-diethoxyethoxy)propane?
The IUPAC name of 2-(2,2-diethoxyethoxy)propane (CID 12600150) is 2-(2,2-diethoxyethoxy)propane.
What is the SMILES notation for 2-(2,2-diethoxyethoxy)propane?
The canonical SMILES for 2-(2,2-diethoxyethoxy)propane is CCOC(COC(C)C)OCC.
What is the InChIKey of 2-(2,2-diethoxyethoxy)propane?
The InChIKey is APQLLWRAYFLKQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O3/c1-5-10-9(11-6-2)7-12-8(3)4/h8-9H,5-7H2,1-4H3.
What are the key properties of 2-(2,2-diethoxyethoxy)propane?
2-(2,2-diethoxyethoxy)propane has a molecular weight of 176.26 g/mol, XLogP of 1.81, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-diethoxyethoxy)propane is sourced from PubChem (CID 12600150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).