About 1-anilino-3-(6H-indolo[3,2-b]quinoxalin-9-yl)urea
1-anilino-3-(6H-indolo[3,2-b]quinoxalin-9-yl)urea (PubChem CID 126002079) has the molecular formula C21H16N6O
and a molecular weight of 368.40 g/mol. Its IUPAC name is 1-anilino-3-(6H-indolo[3,2-b]quinoxalin-9-yl)urea.
Molecular Properties
| Compound Name | 1-anilino-3-(6H-indolo[3,2-b]quinoxalin-9-yl)urea |
| PubChem CID | 126002079 |
| Molecular Formula | C21H16N6O |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 1-anilino-3-(6H-indolo[3,2-b]quinoxalin-9-yl)urea |
| SMILES | O=C(NNc1ccccc1)Nc1ccc2[nH]c3nc4ccccc4nc3c2c1 |
| InChI | InChI=1S/C21H16N6O/c28-21(27-26-13-6-2-1-3-7-13)22-14-10-11-16-15(12-14)19-20(24-16)25-18-9-5-4-8-17(18)23-19/h1-12,26H,(H,24,25)(H2,22,27,28) |
| InChIKey | AFBIFEJERFWGBQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-anilino-3-(6H-indolo[3,2-b]quinoxalin-9-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-anilino-3-(6H-indolo[3,2-b]quinoxalin-9-yl)urea?
The IUPAC name of 1-anilino-3-(6H-indolo[3,2-b]quinoxalin-9-yl)urea (CID 126002079) is 1-anilino-3-(6H-indolo[3,2-b]quinoxalin-9-yl)urea.
What is the SMILES notation for 1-anilino-3-(6H-indolo[3,2-b]quinoxalin-9-yl)urea?
The canonical SMILES for 1-anilino-3-(6H-indolo[3,2-b]quinoxalin-9-yl)urea is O=C(NNc1ccccc1)Nc1ccc2[nH]c3nc4ccccc4nc3c2c1.
What is the InChIKey of 1-anilino-3-(6H-indolo[3,2-b]quinoxalin-9-yl)urea?
The InChIKey is AFBIFEJERFWGBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16N6O/c28-21(27-26-13-6-2-1-3-7-13)22-14-10-11-16-15(12-14)19-20(24-16)25-18-9-5-4-8-17(18)23-19/h1-12,26H,(H,24,25)(H2,22,27,28).
What are the key properties of 1-anilino-3-(6H-indolo[3,2-b]quinoxalin-9-yl)urea?
1-anilino-3-(6H-indolo[3,2-b]quinoxalin-9-yl)urea has a molecular weight of 368.40 g/mol, XLogP of 4.41, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-anilino-3-(6H-indolo[3,2-b]quinoxalin-9-yl)urea is sourced from PubChem (CID 126002079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).