About 9H-thioxanthen-9-ide
9H-thioxanthen-9-ide (PubChem CID 12600230) has the molecular formula C13H9S-
and a molecular weight of 197.28 g/mol. Its IUPAC name is 9H-thioxanthen-9-ide.
Molecular Properties
| Compound Name | 9H-thioxanthen-9-ide |
| PubChem CID | 12600230 |
| Molecular Formula | C13H9S- |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 9H-thioxanthen-9-ide |
| SMILES | c1ccc2c(c1)[CH-]c1ccccc1S2 |
| InChI | InChI=1S/C13H9S/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-9H/q-1 |
| InChIKey | PFJTZJRFJQUYDE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 9H-thioxanthen-9-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-thioxanthen-9-ide?
The IUPAC name of 9H-thioxanthen-9-ide (CID 12600230) is 9H-thioxanthen-9-ide.
What is the SMILES notation for 9H-thioxanthen-9-ide?
The canonical SMILES for 9H-thioxanthen-9-ide is c1ccc2c(c1)[CH-]c1ccccc1S2.
What is the InChIKey of 9H-thioxanthen-9-ide?
The InChIKey is PFJTZJRFJQUYDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9S/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-9H/q-1.
What are the key properties of 9H-thioxanthen-9-ide?
9H-thioxanthen-9-ide has a molecular weight of 197.28 g/mol, XLogP of 3.75, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-thioxanthen-9-ide is sourced from PubChem (CID 12600230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).