C10H12N4S2 — CID 126002712
1-(1,2,3-benzothiadiazol-5-yl)-3-propan-2-ylthiourea (PubChem CID 126002712) has the molecular formula C10H12N4S2 and a molecular weight of 252.37 g/mol. Its IUPAC name is 1-(1,2,3-benzothiadiazol-5-yl)-3-propan-2-ylthiourea.
| Compound Name | 1-(1,2,3-benzothiadiazol-5-yl)-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 126002712 |
| Molecular Formula | C10H12N4S2 |
| Molecular Weight | 252.37 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 1-(1,2,3-benzothiadiazol-5-yl)-3-propan-2-ylthiourea |
| SMILES | CC(C)NC(=S)Nc1ccc2snnc2c1 |
| InChI | InChI=1S/C10H12N4S2/c1-6(2)11-10(15)12-7-3-4-9-8(5-7)13-14-16-9/h3-6H,1-2H3,(H2,11,12,15) |
| InChIKey | KXLPRNQHEGOBNK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|