C18H23N3O2S — CID 126002850
N-[(Z)-[5-(diethylamino)furan-2-yl]methylideneamino]-3-phenylsulfanylpropanamide (PubChem CID 126002850) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is N-[(Z)-[5-(diethylamino)furan-2-yl]methylideneamino]-3-phenylsulfanylpropanamide.
| Compound Name | N-[(Z)-[5-(diethylamino)furan-2-yl]methylideneamino]-3-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 126002850 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | N-[(Z)-[5-(diethylamino)furan-2-yl]methylideneamino]-3-phenylsulfanylpropanamide |
| SMILES | CCN(CC)c1ccc(/C=N\NC(=O)CCSc2ccccc2)o1 |
| InChI | InChI=1S/C18H23N3O2S/c1-3-21(4-2)18-11-10-15(23-18)14-19-20-17(22)12-13-24-16-8-6-5-7-9-16/h5-11,14H,3-4,12-13H2,1-2H3,(H,20,22)/b19-14- |
| InChIKey | LREGROIBMRGDDH-RGEXLXHISA-N |
| XLogP | 3.76 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_furan_A(15)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|