About 1-(1-oxo-1,4-thiazinan-4-yl)ethanone
1-(1-oxo-1,4-thiazinan-4-yl)ethanone (PubChem CID 12600304) has the molecular formula C6H11NO2S
and a molecular weight of 161.23 g/mol. Its IUPAC name is 1-(1-oxo-1,4-thiazinan-4-yl)ethanone.
Molecular Properties
| Compound Name | 1-(1-oxo-1,4-thiazinan-4-yl)ethanone |
| PubChem CID | 12600304 |
| Molecular Formula | C6H11NO2S |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 1-(1-oxo-1,4-thiazinan-4-yl)ethanone |
| SMILES | CC(=O)N1CCS(=O)CC1 |
| InChI | InChI=1S/C6H11NO2S/c1-6(8)7-2-4-10(9)5-3-7/h2-5H2,1H3 |
| InChIKey | PCYGKDZHAISJSZ-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1-oxo-1,4-thiazinan-4-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-oxo-1,4-thiazinan-4-yl)ethanone?
The IUPAC name of 1-(1-oxo-1,4-thiazinan-4-yl)ethanone (CID 12600304) is 1-(1-oxo-1,4-thiazinan-4-yl)ethanone.
What is the SMILES notation for 1-(1-oxo-1,4-thiazinan-4-yl)ethanone?
The canonical SMILES for 1-(1-oxo-1,4-thiazinan-4-yl)ethanone is CC(=O)N1CCS(=O)CC1.
What is the InChIKey of 1-(1-oxo-1,4-thiazinan-4-yl)ethanone?
The InChIKey is PCYGKDZHAISJSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2S/c1-6(8)7-2-4-10(9)5-3-7/h2-5H2,1H3.
What are the key properties of 1-(1-oxo-1,4-thiazinan-4-yl)ethanone?
1-(1-oxo-1,4-thiazinan-4-yl)ethanone has a molecular weight of 161.23 g/mol, XLogP of -0.40, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-oxo-1,4-thiazinan-4-yl)ethanone is sourced from PubChem (CID 12600304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).