C23H29N5O4 — CID 126003279
N-[(Z)-[2-(diethylamino)-5-nitrophenyl]methylideneamino]-4-(morpholin-4-ylmethyl)benzamide (PubChem CID 126003279) has the molecular formula C23H29N5O4 and a molecular weight of 439.52 g/mol. Its IUPAC name is N-[(Z)-[2-(diethylamino)-5-nitrophenyl]methylideneamino]-4-(morpholin-4-ylmethyl)benzamide.
| Compound Name | N-[(Z)-[2-(diethylamino)-5-nitrophenyl]methylideneamino]-4-(morpholin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 126003279 |
| Molecular Formula | C23H29N5O4 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | N-[(Z)-[2-(diethylamino)-5-nitrophenyl]methylideneamino]-4-(morpholin-4-ylmethyl)benzamide |
| SMILES | CCN(CC)c1ccc([N+](=O)[O-])cc1/C=N\NC(=O)c1ccc(CN2CCOCC2)cc1 |
| InChI | InChI=1S/C23H29N5O4/c1-3-27(4-2)22-10-9-21(28(30)31)15-20(22)16-24-25-23(29)19-7-5-18(6-8-19)17-26-11-13-32-14-12-26/h5-10,15-16H,3-4,11-14,17H2,1-2H3,(H,25,29)/b24-16- |
| InChIKey | MBMURYZNAYCXSE-JLPGSUDCSA-N |
| XLogP | 3.04 |
| TPSA | 100.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|