C8H10 — CID 12600339
(1R,2S,4R,5S)-tricyclo[3.2.1.02,4]oct-6-ene (PubChem CID 12600339) has the molecular formula C8H10 and a molecular weight of 106.17 g/mol. Its IUPAC name is (1R,2S,4R,5S)-tricyclo[3.2.1.02,4]oct-6-ene.
| Compound Name | (1R,2S,4R,5S)-tricyclo[3.2.1.02,4]oct-6-ene |
|---|---|
| PubChem CID | 12600339 |
| Molecular Formula | C8H10 |
| Molecular Weight | 106.17 g/mol |
| Exact Mass | 106.08 |
| IUPAC Name | (1R,2S,4R,5S)-tricyclo[3.2.1.02,4]oct-6-ene |
| SMILES | C1=C[C@H]2C[C@@H]1[C@H]1C[C@H]12 |
| InChI | InChI=1S/C8H10/c1-2-6-3-5(1)7-4-8(6)7/h1-2,5-8H,3-4H2/t5-,6+,7-,8+ |
| InChIKey | ZYVIMZRTFMWLDQ-KVFPUHGPSA-N |
| XLogP | 1.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 106.17 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|