C7H9ClN2 — CID 12600391
4-chloro-2,5,6-trimethylpyrimidine (PubChem CID 12600391) has the molecular formula C7H9ClN2 and a molecular weight of 156.62 g/mol. Its IUPAC name is 4-chloro-2,5,6-trimethylpyrimidine.
| Compound Name | 4-chloro-2,5,6-trimethylpyrimidine |
|---|---|
| PubChem CID | 12600391 |
| Molecular Formula | C7H9ClN2 |
| Molecular Weight | 156.62 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 4-chloro-2,5,6-trimethylpyrimidine |
| SMILES | Cc1nc(C)c(C)c(Cl)n1 |
| InChI | InChI=1S/C7H9ClN2/c1-4-5(2)9-6(3)10-7(4)8/h1-3H3 |
| InChIKey | DIZOLBAICJZMSH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.62 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |