C20H23ClN2O4 — CID 126005930
benzyl N-[(2S)-1-(5-chloro-2-methoxyanilino)-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 126005930) has the molecular formula C20H23ClN2O4 and a molecular weight of 390.87 g/mol. Its IUPAC name is benzyl N-[(2S)-1-(5-chloro-2-methoxyanilino)-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-(5-chloro-2-methoxyanilino)-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 126005930 |
| Molecular Formula | C20H23ClN2O4 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | benzyl N-[(2S)-1-(5-chloro-2-methoxyanilino)-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | COc1ccc(Cl)cc1NC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C20H23ClN2O4/c1-13(2)18(23-20(25)27-12-14-7-5-4-6-8-14)19(24)22-16-11-15(21)9-10-17(16)26-3/h4-11,13,18H,12H2,1-3H3,(H,22,24)(H,23,25)/t18-/m0/s1 |
| InChIKey | QVSUVZRQHMOARK-SFHVURJKSA-N |
| XLogP | 4.24 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |