C17H13F5N2O3 — CID 126008383
[(5R)-5-hydroxy-5-(1,1,2,2,2-pentafluoroethyl)-3-phenyl-4H-pyrazol-1-yl]-(5-methylfuran-2-yl)methanone (PubChem CID 126008383) has the molecular formula C17H13F5N2O3 and a molecular weight of 388.29 g/mol. Its IUPAC name is [(5R)-5-hydroxy-5-(1,1,2,2,2-pentafluoroethyl)-3-phenyl-4H-pyrazol-1-yl]-(5-methylfuran-2-yl)methanone.
| Compound Name | [(5R)-5-hydroxy-5-(1,1,2,2,2-pentafluoroethyl)-3-phenyl-4H-pyrazol-1-yl]-(5-methylfuran-2-yl)methanone |
|---|---|
| PubChem CID | 126008383 |
| Molecular Formula | C17H13F5N2O3 |
| Molecular Weight | 388.29 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | [(5R)-5-hydroxy-5-(1,1,2,2,2-pentafluoroethyl)-3-phenyl-4H-pyrazol-1-yl]-(5-methylfuran-2-yl)methanone |
| SMILES | Cc1ccc(C(=O)N2N=C(c3ccccc3)C[C@@]2(O)C(F)(F)C(F)(F)F)o1 |
| InChI | InChI=1S/C17H13F5N2O3/c1-10-7-8-13(27-10)14(25)24-15(26,16(18,19)17(20,21)22)9-12(23-24)11-5-3-2-4-6-11/h2-8,26H,9H2,1H3/t15-/m1/s1 |
| InChIKey | KGSXRTFRUSPUBY-OAHLLOKOSA-N |
| XLogP | 3.72 |
| TPSA | 66.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.29 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|