C18H20N2O4 — CID 126009593
phenyl N-[(2S)-1-(2-methoxy-5-methylanilino)-1-oxopropan-2-yl]carbamate (PubChem CID 126009593) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is phenyl N-[(2S)-1-(2-methoxy-5-methylanilino)-1-oxopropan-2-yl]carbamate.
| Compound Name | phenyl N-[(2S)-1-(2-methoxy-5-methylanilino)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 126009593 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | phenyl N-[(2S)-1-(2-methoxy-5-methylanilino)-1-oxopropan-2-yl]carbamate |
| SMILES | COc1ccc(C)cc1NC(=O)[C@H](C)NC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C18H20N2O4/c1-12-9-10-16(23-3)15(11-12)20-17(21)13(2)19-18(22)24-14-7-5-4-6-8-14/h4-11,13H,1-3H3,(H,19,22)(H,20,21)/t13-/m0/s1 |
| InChIKey | QMNKHXAULLOHAM-ZDUSSCGKSA-N |
| XLogP | 3.12 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |