C13H20O — CID 12600978
3,3a,7,7-tetramethyl-4,5,6,7a-tetrahydroinden-1-one (PubChem CID 12600978) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is 3,3a,7,7-tetramethyl-4,5,6,7a-tetrahydroinden-1-one.
| Compound Name | 3,3a,7,7-tetramethyl-4,5,6,7a-tetrahydroinden-1-one |
|---|---|
| PubChem CID | 12600978 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 3,3a,7,7-tetramethyl-4,5,6,7a-tetrahydroinden-1-one |
| SMILES | CC1=CC(=O)C2C(C)(C)CCCC12C |
| InChI | InChI=1S/C13H20O/c1-9-8-10(14)11-12(2,3)6-5-7-13(9,11)4/h8,11H,5-7H2,1-4H3 |
| InChIKey | VNZLXHULMGQBBV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |