About N-[(2R,6S)-2,6-diphenyloxan-4-yl]acetamide
N-[(2R,6S)-2,6-diphenyloxan-4-yl]acetamide (PubChem CID 12601075) has the molecular formula C19H21NO2
and a molecular weight of 295.38 g/mol. Its IUPAC name is N-[(2R,6S)-2,6-diphenyloxan-4-yl]acetamide.
Molecular Properties
| Compound Name | N-[(2R,6S)-2,6-diphenyloxan-4-yl]acetamide |
| PubChem CID | 12601075 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | N-[(2R,6S)-2,6-diphenyloxan-4-yl]acetamide |
| SMILES | CC(=O)NC1C[C@@H](c2ccccc2)O[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C19H21NO2/c1-14(21)20-17-12-18(15-8-4-2-5-9-15)22-19(13-17)16-10-6-3-7-11-16/h2-11,17-19H,12-13H2,1H3,(H,20,21)/t17?,18-,19+ |
| InChIKey | GMMGIJDSULCMGY-YQQQUEKLSA-N |
| XLogP | 3.78 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(2R,6S)-2,6-diphenyloxan-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R,6S)-2,6-diphenyloxan-4-yl]acetamide?
The IUPAC name of N-[(2R,6S)-2,6-diphenyloxan-4-yl]acetamide (CID 12601075) is N-[(2R,6S)-2,6-diphenyloxan-4-yl]acetamide.
What is the SMILES notation for N-[(2R,6S)-2,6-diphenyloxan-4-yl]acetamide?
The canonical SMILES for N-[(2R,6S)-2,6-diphenyloxan-4-yl]acetamide is CC(=O)NC1C[C@@H](c2ccccc2)O[C@@H](c2ccccc2)C1.
What is the InChIKey of N-[(2R,6S)-2,6-diphenyloxan-4-yl]acetamide?
The InChIKey is GMMGIJDSULCMGY-YQQQUEKLSA-N. The full InChI is InChI=1S/C19H21NO2/c1-14(21)20-17-12-18(15-8-4-2-5-9-15)22-19(13-17)16-10-6-3-7-11-16/h2-11,17-19H,12-13H2,1H3,(H,20,21)/t17?,18-,19+.
What are the key properties of N-[(2R,6S)-2,6-diphenyloxan-4-yl]acetamide?
N-[(2R,6S)-2,6-diphenyloxan-4-yl]acetamide has a molecular weight of 295.38 g/mol, XLogP of 3.78, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R,6S)-2,6-diphenyloxan-4-yl]acetamide is sourced from PubChem (CID 12601075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).