C15H20IN5OS — CID 126014411
2-[(4-amino-5-ethyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-iodo-2-propan-2-ylphenyl)acetamide (PubChem CID 126014411) has the molecular formula C15H20IN5OS and a molecular weight of 445.33 g/mol. Its IUPAC name is 2-[(4-amino-5-ethyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-iodo-2-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[(4-amino-5-ethyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-iodo-2-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 126014411 |
| Molecular Formula | C15H20IN5OS |
| Molecular Weight | 445.33 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | 2-[(4-amino-5-ethyl-1,2,4-triazol-3-yl)sulfanyl]-N-(4-iodo-2-propan-2-ylphenyl)acetamide |
| SMILES | CCc1nnc(SCC(=O)Nc2ccc(I)cc2C(C)C)n1N |
| InChI | InChI=1S/C15H20IN5OS/c1-4-13-19-20-15(21(13)17)23-8-14(22)18-12-6-5-10(16)7-11(12)9(2)3/h5-7,9H,4,8,17H2,1-3H3,(H,18,22) |
| InChIKey | SBBPWTWZNGSVPI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|