C7H12O2 — CID 12601559
2,3,5-trimethyl-2,3-dihydro-1,4-dioxine (PubChem CID 12601559) has the molecular formula C7H12O2 and a molecular weight of 128.17 g/mol. Its IUPAC name is 2,3,5-trimethyl-2,3-dihydro-1,4-dioxine.
| Compound Name | 2,3,5-trimethyl-2,3-dihydro-1,4-dioxine |
|---|---|
| PubChem CID | 12601559 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | 2,3,5-trimethyl-2,3-dihydro-1,4-dioxine |
| SMILES | CC1=COC(C)C(C)O1 |
| InChI | InChI=1S/C7H12O2/c1-5-4-8-6(2)7(3)9-5/h4,6-7H,1-3H3 |
| InChIKey | ZXTGNLMXFNGOJM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |