C23H23ClN2O6S — CID 126015841
(5E)-3-[(2S)-butan-2-yl]-5-[[3-chloro-5-ethoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126015841) has the molecular formula C23H23ClN2O6S and a molecular weight of 490.97 g/mol. Its IUPAC name is (5E)-3-[(2S)-butan-2-yl]-5-[[3-chloro-5-ethoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[(2S)-butan-2-yl]-5-[[3-chloro-5-ethoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126015841 |
| Molecular Formula | C23H23ClN2O6S |
| Molecular Weight | 490.97 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | (5E)-3-[(2S)-butan-2-yl]-5-[[3-chloro-5-ethoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2/SC(=O)N([C@@H](C)CC)C2=O)cc(Cl)c1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H23ClN2O6S/c1-4-14(3)25-22(27)20(33-23(25)28)12-16-10-18(24)21(19(11-16)31-5-2)32-13-15-7-6-8-17(9-15)26(29)30/h6-12,14H,4-5,13H2,1-3H3/b20-12+/t14-/m0/s1 |
| InChIKey | CKNBSBKABKIFMW-PVGUKEHMSA-N |
| XLogP | 6.06 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.97 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|