C21H36S5 — CID 12601758
1,2,3,4,5-pentakis(propan-2-ylsulfanyl)benzene (PubChem CID 12601758) has the molecular formula C21H36S5 and a molecular weight of 448.85 g/mol. Its IUPAC name is 1,2,3,4,5-pentakis(propan-2-ylsulfanyl)benzene.
| Compound Name | 1,2,3,4,5-pentakis(propan-2-ylsulfanyl)benzene |
|---|---|
| PubChem CID | 12601758 |
| Molecular Formula | C21H36S5 |
| Molecular Weight | 448.85 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 1,2,3,4,5-pentakis(propan-2-ylsulfanyl)benzene |
| SMILES | CC(C)Sc1cc(SC(C)C)c(SC(C)C)c(SC(C)C)c1SC(C)C |
| InChI | InChI=1S/C21H36S5/c1-12(2)22-17-11-18(23-13(3)4)20(25-15(7)8)21(26-16(9)10)19(17)24-14(5)6/h11-16H,1-10H3 |
| InChIKey | HDIFWDURQDSNCP-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.85 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |