C21H24BrNO8S — CID 126020117
ethyl (2R)-2-[(5E)-5-[[3-bromo-5-ethoxy-4-(2-ethoxy-2-oxoethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate (PubChem CID 126020117) has the molecular formula C21H24BrNO8S and a molecular weight of 530.39 g/mol. Its IUPAC name is ethyl (2R)-2-[(5E)-5-[[3-bromo-5-ethoxy-4-(2-ethoxy-2-oxoethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | ethyl (2R)-2-[(5E)-5-[[3-bromo-5-ethoxy-4-(2-ethoxy-2-oxoethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 126020117 |
| Molecular Formula | C21H24BrNO8S |
| Molecular Weight | 530.39 g/mol |
| Exact Mass | 529.04 |
| IUPAC Name | ethyl (2R)-2-[(5E)-5-[[3-bromo-5-ethoxy-4-(2-ethoxy-2-oxoethoxy)phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
| SMILES | CCOC(=O)COc1c(Br)cc(/C=C2/SC(=O)N([C@H](C)C(=O)OCC)C2=O)cc1OCC |
| InChI | InChI=1S/C21H24BrNO8S/c1-5-28-15-9-13(8-14(22)18(15)31-11-17(24)29-6-2)10-16-19(25)23(21(27)32-16)12(4)20(26)30-7-3/h8-10,12H,5-7,11H2,1-4H3/b16-10+/t12-/m1/s1 |
| InChIKey | AZYWMGFGVDFEHV-HMHNVIDESA-N |
| XLogP | 3.78 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|