C24H17BrClFN2O3 — CID 126021313
(5E)-5-[[5-bromo-2-[(4-chlorophenyl)methoxy]phenyl]methylidene]-3-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione (PubChem CID 126021313) has the molecular formula C24H17BrClFN2O3 and a molecular weight of 515.77 g/mol. Its IUPAC name is (5E)-5-[[5-bromo-2-[(4-chlorophenyl)methoxy]phenyl]methylidene]-3-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[5-bromo-2-[(4-chlorophenyl)methoxy]phenyl]methylidene]-3-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126021313 |
| Molecular Formula | C24H17BrClFN2O3 |
| Molecular Weight | 515.77 g/mol |
| Exact Mass | 514.01 |
| IUPAC Name | (5E)-5-[[5-bromo-2-[(4-chlorophenyl)methoxy]phenyl]methylidene]-3-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1N/C(=C/c2cc(Br)ccc2OCc2ccc(Cl)cc2)C(=O)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C24H17BrClFN2O3/c25-18-5-10-22(32-14-16-1-6-19(26)7-2-16)17(11-18)12-21-23(30)29(24(31)28-21)13-15-3-8-20(27)9-4-15/h1-12H,13-14H2,(H,28,31)/b21-12+ |
| InChIKey | YGGJGCWWBGWTJQ-CIAFOILYSA-N |
| XLogP | 5.91 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.77 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|