About lithium 2-methanidylbutane
lithium 2-methanidylbutane (PubChem CID 12602290) has the molecular formula C5H11Li
and a molecular weight of 78.08 g/mol. Its IUPAC name is lithium 2-methanidylbutane.
Molecular Properties
| Compound Name | lithium 2-methanidylbutane |
| PubChem CID | 12602290 |
| Molecular Formula | C5H11Li |
| Molecular Weight | 78.08 g/mol |
| Exact Mass | 78.10 |
| IUPAC Name | lithium 2-methanidylbutane |
| SMILES | [CH2-]C(C)CC.[Li+] |
| InChI | InChI=1S/C5H11.Li/c1-4-5(2)3;/h5H,2,4H2,1,3H3;/q-1;+1 |
| InChIKey | ZZBJHYICONGREL-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 78.08 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium 2-methanidylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 2-methanidylbutane?
The IUPAC name of lithium 2-methanidylbutane (CID 12602290) is lithium 2-methanidylbutane.
What is the SMILES notation for lithium 2-methanidylbutane?
The canonical SMILES for lithium 2-methanidylbutane is [CH2-]C(C)CC.[Li+].
What is the InChIKey of lithium 2-methanidylbutane?
The InChIKey is ZZBJHYICONGREL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11.Li/c1-4-5(2)3;/h5H,2,4H2,1,3H3;/q-1;+1.
What are the key properties of lithium 2-methanidylbutane?
lithium 2-methanidylbutane has a molecular weight of 78.08 g/mol, XLogP of -1.13, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 2-methanidylbutane is sourced from PubChem (CID 12602290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).