C24H21Cl2N3O3 — CID 126023505
3,4-dichloro-N-[(Z)-[3-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide (PubChem CID 126023505) has the molecular formula C24H21Cl2N3O3 and a molecular weight of 470.36 g/mol. Its IUPAC name is 3,4-dichloro-N-[(Z)-[3-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 3,4-dichloro-N-[(Z)-[3-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126023505 |
| Molecular Formula | C24H21Cl2N3O3 |
| Molecular Weight | 470.36 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | 3,4-dichloro-N-[(Z)-[3-[2-(3,4-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]benzamide |
| SMILES | Cc1ccc(NC(=O)COc2cccc(/C=N\NC(=O)c3ccc(Cl)c(Cl)c3)c2)cc1C |
| InChI | InChI=1S/C24H21Cl2N3O3/c1-15-6-8-19(10-16(15)2)28-23(30)14-32-20-5-3-4-17(11-20)13-27-29-24(31)18-7-9-21(25)22(26)12-18/h3-13H,14H2,1-2H3,(H,28,30)(H,29,31)/b27-13- |
| InChIKey | UGWRWWILYGSDIW-WKIKZPBSSA-N |
| XLogP | 5.39 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.36 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|