C32H31N3O8S — CID 126024190
2-methoxyethyl (2E,5R)-7-methyl-2-[[5-(2-methyl-5-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5-(2-propan-2-yloxyphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 126024190) has the molecular formula C32H31N3O8S and a molecular weight of 617.68 g/mol. Its IUPAC name is 2-methoxyethyl (2E,5R)-7-methyl-2-[[5-(2-methyl-5-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5-(2-propan-2-yloxyphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | 2-methoxyethyl (2E,5R)-7-methyl-2-[[5-(2-methyl-5-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5-(2-propan-2-yloxyphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 126024190 |
| Molecular Formula | C32H31N3O8S |
| Molecular Weight | 617.68 g/mol |
| Exact Mass | 617.18 |
| IUPAC Name | 2-methoxyethyl (2E,5R)-7-methyl-2-[[5-(2-methyl-5-nitrophenyl)furan-2-yl]methylidene]-3-oxo-5-(2-propan-2-yloxyphenyl)-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | COCCOC(=O)C1=C(C)N=c2s/c(=C/c3ccc(-c4cc([N+](=O)[O-])ccc4C)o3)c(=O)n2[C@@H]1c1ccccc1OC(C)C |
| InChI | InChI=1S/C32H31N3O8S/c1-18(2)42-25-9-7-6-8-23(25)29-28(31(37)41-15-14-40-5)20(4)33-32-34(29)30(36)27(44-32)17-22-12-13-26(43-22)24-16-21(35(38)39)11-10-19(24)3/h6-13,16-18,29H,14-15H2,1-5H3/b27-17+/t29-/m1/s1 |
| InChIKey | SJWFVGUOYFJUPJ-NULZLWRNSA-N |
| XLogP | 4.69 |
| TPSA | 135.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.68 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|