C22H24 — CID 12602572
(3E)-3-(4,7-dimethyl-2,3-dihydroinden-1-ylidene)-4,7-dimethyl-1,2-dihydroindene (PubChem CID 12602572) has the molecular formula C22H24 and a molecular weight of 288.43 g/mol. Its IUPAC name is (3E)-3-(4,7-dimethyl-2,3-dihydroinden-1-ylidene)-4,7-dimethyl-1,2-dihydroindene.
| Compound Name | (3E)-3-(4,7-dimethyl-2,3-dihydroinden-1-ylidene)-4,7-dimethyl-1,2-dihydroindene |
|---|---|
| PubChem CID | 12602572 |
| Molecular Formula | C22H24 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | (3E)-3-(4,7-dimethyl-2,3-dihydroinden-1-ylidene)-4,7-dimethyl-1,2-dihydroindene |
| SMILES | Cc1ccc(C)c2c1CC/C2=C1/CCc2c(C)ccc(C)c21 |
| InChI | InChI=1S/C22H24/c1-13-5-7-15(3)21-17(13)9-11-19(21)20-12-10-18-14(2)6-8-16(4)22(18)20/h5-8H,9-12H2,1-4H3/b20-19+ |
| InChIKey | ZTMONYYBCCCDET-FMQUCBEESA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|