C8H14O2S — CID 12602748
(3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene 2,2-dioxide (PubChem CID 12602748) has the molecular formula C8H14O2S and a molecular weight of 174.26 g/mol. Its IUPAC name is (3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene 2,2-dioxide.
| Compound Name | (3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene 2,2-dioxide |
|---|---|
| PubChem CID | 12602748 |
| Molecular Formula | C8H14O2S |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | (3aS,7aR)-1,3,3a,4,5,6,7,7a-octahydro-2-benzothiophene 2,2-dioxide |
| SMILES | O=S1(=O)C[C@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C8H14O2S/c9-11(10)5-7-3-1-2-4-8(7)6-11/h7-8H,1-6H2/t7-,8+ |
| InChIKey | VGQCRPHTIKWVRB-OCAPTIKFSA-N |
| XLogP | 1.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |