About 2-piperazin-1-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine
2-piperazin-1-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine (PubChem CID 12602894) has the molecular formula C11H17N5
and a molecular weight of 219.29 g/mol. Its IUPAC name is 2-piperazin-1-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-piperazin-1-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine |
| PubChem CID | 12602894 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 2-piperazin-1-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine |
| SMILES | Nc1nc(N2CCNCC2)nc2c1CCC2 |
| InChI | InChI=1S/C11H17N5/c12-10-8-2-1-3-9(8)14-11(15-10)16-6-4-13-5-7-16/h13H,1-7H2,(H2,12,14,15) |
| InChIKey | PLOUXVANAUXQCE-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-piperazin-1-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperazin-1-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine?
The IUPAC name of 2-piperazin-1-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine (CID 12602894) is 2-piperazin-1-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine.
What is the SMILES notation for 2-piperazin-1-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine?
The canonical SMILES for 2-piperazin-1-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine is Nc1nc(N2CCNCC2)nc2c1CCC2.
What is the InChIKey of 2-piperazin-1-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine?
The InChIKey is PLOUXVANAUXQCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N5/c12-10-8-2-1-3-9(8)14-11(15-10)16-6-4-13-5-7-16/h13H,1-7H2,(H2,12,14,15).
What are the key properties of 2-piperazin-1-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine?
2-piperazin-1-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine has a molecular weight of 219.29 g/mol, XLogP of -0.04, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperazin-1-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine is sourced from PubChem (CID 12602894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).