C12H19N5 — CID 12602897
2-piperazin-1-yl-5,6,7,8-tetrahydroquinazolin-4-amine (PubChem CID 12602897) has the molecular formula C12H19N5 and a molecular weight of 233.32 g/mol. Its IUPAC name is 2-piperazin-1-yl-5,6,7,8-tetrahydroquinazolin-4-amine.
| Compound Name | 2-piperazin-1-yl-5,6,7,8-tetrahydroquinazolin-4-amine |
|---|---|
| PubChem CID | 12602897 |
| Molecular Formula | C12H19N5 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 2-piperazin-1-yl-5,6,7,8-tetrahydroquinazolin-4-amine |
| SMILES | Nc1nc(N2CCNCC2)nc2c1CCCC2 |
| InChI | InChI=1S/C12H19N5/c13-11-9-3-1-2-4-10(9)15-12(16-11)17-7-5-14-6-8-17/h14H,1-8H2,(H2,13,15,16) |
| InChIKey | HXBNKGHRFDXJIC-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |