About 1,4-dichloro-2,3-dimethoxybutane
1,4-dichloro-2,3-dimethoxybutane (PubChem CID 12602936) has the molecular formula C6H12Cl2O2
and a molecular weight of 187.07 g/mol. Its IUPAC name is 1,4-dichloro-2,3-dimethoxybutane.
Molecular Properties
| Compound Name | 1,4-dichloro-2,3-dimethoxybutane |
| PubChem CID | 12602936 |
| Molecular Formula | C6H12Cl2O2 |
| Molecular Weight | 187.07 g/mol |
| Exact Mass | 186.02 |
| IUPAC Name | 1,4-dichloro-2,3-dimethoxybutane |
| SMILES | COC(CCl)C(CCl)OC |
| InChI | InChI=1S/C6H12Cl2O2/c1-9-5(3-7)6(4-8)10-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | MGWJCJGWHNBJDJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.07 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dichloro-2,3-dimethoxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dichloro-2,3-dimethoxybutane?
The IUPAC name of 1,4-dichloro-2,3-dimethoxybutane (CID 12602936) is 1,4-dichloro-2,3-dimethoxybutane.
What is the SMILES notation for 1,4-dichloro-2,3-dimethoxybutane?
The canonical SMILES for 1,4-dichloro-2,3-dimethoxybutane is COC(CCl)C(CCl)OC.
What is the InChIKey of 1,4-dichloro-2,3-dimethoxybutane?
The InChIKey is MGWJCJGWHNBJDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12Cl2O2/c1-9-5(3-7)6(4-8)10-2/h5-6H,3-4H2,1-2H3.
What are the key properties of 1,4-dichloro-2,3-dimethoxybutane?
1,4-dichloro-2,3-dimethoxybutane has a molecular weight of 187.07 g/mol, XLogP of 1.49, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dichloro-2,3-dimethoxybutane is sourced from PubChem (CID 12602936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).