C17H13ClN2O3 — CID 126030334
5-chloro-N-[(E)-[(E)-3-(furan-2-yl)-2-methylprop-2-enylidene]amino]-1-benzofuran-2-carboxamide (PubChem CID 126030334) has the molecular formula C17H13ClN2O3 and a molecular weight of 328.76 g/mol. Its IUPAC name is 5-chloro-N-[(E)-[(E)-3-(furan-2-yl)-2-methylprop-2-enylidene]amino]-1-benzofuran-2-carboxamide.
| Compound Name | 5-chloro-N-[(E)-[(E)-3-(furan-2-yl)-2-methylprop-2-enylidene]amino]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 126030334 |
| Molecular Formula | C17H13ClN2O3 |
| Molecular Weight | 328.76 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 5-chloro-N-[(E)-[(E)-3-(furan-2-yl)-2-methylprop-2-enylidene]amino]-1-benzofuran-2-carboxamide |
| SMILES | CC(/C=N/NC(=O)c1cc2cc(Cl)ccc2o1)=C\c1ccco1 |
| InChI | InChI=1S/C17H13ClN2O3/c1-11(7-14-3-2-6-22-14)10-19-20-17(21)16-9-12-8-13(18)4-5-15(12)23-16/h2-10H,1H3,(H,20,21)/b11-7+,19-10+ |
| InChIKey | OPKJBBSMWVVJMT-WWHQGWBQSA-N |
| XLogP | 4.50 |
| TPSA | 67.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.76 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|