About (E)-but-2-en-2-amine
(E)-but-2-en-2-amine (PubChem CID 12603155) has the molecular formula C4H9N
and a molecular weight of 71.12 g/mol. Its IUPAC name is (E)-but-2-en-2-amine.
Molecular Properties
| Compound Name | (E)-but-2-en-2-amine |
| PubChem CID | 12603155 |
| Molecular Formula | C4H9N |
| Molecular Weight | 71.12 g/mol |
| Exact Mass | 71.07 |
| IUPAC Name | (E)-but-2-en-2-amine |
| SMILES | C/C=C(\C)N |
| InChI | InChI=1S/C4H9N/c1-3-4(2)5/h3H,5H2,1-2H3/b4-3+ |
| InChIKey | KZFUWRMVPLBQKD-ONEGZZNKSA-N |
| XLogP | 0.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 71.12 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (E)-but-2-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-en-2-amine?
The IUPAC name of (E)-but-2-en-2-amine (CID 12603155) is (E)-but-2-en-2-amine.
What is the SMILES notation for (E)-but-2-en-2-amine?
The canonical SMILES for (E)-but-2-en-2-amine is C/C=C(\C)N.
What is the InChIKey of (E)-but-2-en-2-amine?
The InChIKey is KZFUWRMVPLBQKD-ONEGZZNKSA-N. The full InChI is InChI=1S/C4H9N/c1-3-4(2)5/h3H,5H2,1-2H3/b4-3+.
What are the key properties of (E)-but-2-en-2-amine?
(E)-but-2-en-2-amine has a molecular weight of 71.12 g/mol, XLogP of 0.87, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-en-2-amine is sourced from PubChem (CID 12603155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).