C21H17Cl2N3O4S — CID 126032099
2-[[2-[N-(benzenesulfonyl)-3,4-dichloroanilino]acetyl]amino]benzamide (PubChem CID 126032099) has the molecular formula C21H17Cl2N3O4S and a molecular weight of 478.36 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-3,4-dichloroanilino]acetyl]amino]benzamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-3,4-dichloroanilino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 126032099 |
| Molecular Formula | C21H17Cl2N3O4S |
| Molecular Weight | 478.36 g/mol |
| Exact Mass | 477.03 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-3,4-dichloroanilino]acetyl]amino]benzamide |
| SMILES | NC(=O)c1ccccc1NC(=O)CN(c1ccc(Cl)c(Cl)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H17Cl2N3O4S/c22-17-11-10-14(12-18(17)23)26(31(29,30)15-6-2-1-3-7-15)13-20(27)25-19-9-5-4-8-16(19)21(24)28/h1-12H,13H2,(H2,24,28)(H,25,27) |
| InChIKey | WMCINZPGYSBGMP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |