C21H18BrClN2O3S — CID 126035125
N-(4-bromo-3-methylphenyl)-2-(N-(4-chlorophenyl)sulfonylanilino)acetamide (PubChem CID 126035125) has the molecular formula C21H18BrClN2O3S and a molecular weight of 493.81 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-2-(N-(4-chlorophenyl)sulfonylanilino)acetamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-2-(N-(4-chlorophenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 126035125 |
| Molecular Formula | C21H18BrClN2O3S |
| Molecular Weight | 493.81 g/mol |
| Exact Mass | 491.99 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-2-(N-(4-chlorophenyl)sulfonylanilino)acetamide |
| SMILES | Cc1cc(NC(=O)CN(c2ccccc2)S(=O)(=O)c2ccc(Cl)cc2)ccc1Br |
| InChI | InChI=1S/C21H18BrClN2O3S/c1-15-13-17(9-12-20(15)22)24-21(26)14-25(18-5-3-2-4-6-18)29(27,28)19-10-7-16(23)8-11-19/h2-13H,14H2,1H3,(H,24,26) |
| InChIKey | QHULHUDSNXFXGK-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.81 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |