C28H24N4O6S — CID 126035787
2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]amino]-N-benzylbenzamide (PubChem CID 126035787) has the molecular formula C28H24N4O6S and a molecular weight of 544.59 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]amino]-N-benzylbenzamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]amino]-N-benzylbenzamide |
|---|---|
| PubChem CID | 126035787 |
| Molecular Formula | C28H24N4O6S |
| Molecular Weight | 544.59 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-4-nitroanilino]acetyl]amino]-N-benzylbenzamide |
| SMILES | O=C(CN(c1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1ccccc1)Nc1ccccc1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C28H24N4O6S/c33-27(30-26-14-8-7-13-25(26)28(34)29-19-21-9-3-1-4-10-21)20-31(22-15-17-23(18-16-22)32(35)36)39(37,38)24-11-5-2-6-12-24/h1-18H,19-20H2,(H,29,34)(H,30,33) |
| InChIKey | ZYEUOKBWTCIGFJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 138.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.59 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|