C24H18F5N3 — CID 126035974
N-[(E)-(1-benzyl-2,7-dimethylindol-3-yl)methylideneamino]-2,3,4,5,6-pentafluoroaniline (PubChem CID 126035974) has the molecular formula C24H18F5N3 and a molecular weight of 443.42 g/mol. Its IUPAC name is N-[(E)-(1-benzyl-2,7-dimethylindol-3-yl)methylideneamino]-2,3,4,5,6-pentafluoroaniline.
| Compound Name | N-[(E)-(1-benzyl-2,7-dimethylindol-3-yl)methylideneamino]-2,3,4,5,6-pentafluoroaniline |
|---|---|
| PubChem CID | 126035974 |
| Molecular Formula | C24H18F5N3 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | N-[(E)-(1-benzyl-2,7-dimethylindol-3-yl)methylideneamino]-2,3,4,5,6-pentafluoroaniline |
| SMILES | Cc1cccc2c(/C=N/Nc3c(F)c(F)c(F)c(F)c3F)c(C)n(Cc3ccccc3)c12 |
| InChI | InChI=1S/C24H18F5N3/c1-13-7-6-10-16-17(14(2)32(24(13)16)12-15-8-4-3-5-9-15)11-30-31-23-21(28)19(26)18(25)20(27)22(23)29/h3-11,31H,12H2,1-2H3/b30-11+ |
| InChIKey | AQYGHCXYVMKULP-KNBZMSCYSA-N |
| XLogP | 6.45 |
| TPSA | 29.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|